ChemNet > CAS > 499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
उत्पाद का नाम |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate |
समानार्थी |
methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
आणविक फार्मूला |
C12H15N3O2S |
आण्विक वजन |
265.3314 |
InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
कैस रजिस्टी संख्या |
499771-09-4 |
आणविक संरचना |
|
घनत्व |
1.33g/cm3 |
गलनांक |
183℃ |
उबलने का समय |
506.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.613 |
फ्लैश प्वाइंट |
259.9°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|